C19H26N2O4 — CID 67588670
N'-(3,5-diacetylphenyl)nonanediamide (PubChem CID 67588670) has the molecular formula C19H26N2O4 and a molecular weight of 346.43 g/mol. Its IUPAC name is N'-(3,5-diacetylphenyl)nonanediamide.
| Compound Name | N'-(3,5-diacetylphenyl)nonanediamide |
|---|---|
| PubChem CID | 67588670 |
| Molecular Formula | C19H26N2O4 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.19 |
| IUPAC Name | N'-(3,5-diacetylphenyl)nonanediamide |
| SMILES | CC(=O)c1cc(NC(=O)CCCCCCCC(N)=O)cc(C(C)=O)c1 |
| InChI | InChI=1S/C19H26N2O4/c1-13(22)15-10-16(14(2)23)12-17(11-15)21-19(25)9-7-5-3-4-6-8-18(20)24/h10-12H,3-9H2,1-2H3,(H2,20,24)(H,21,25) |
| InChIKey | ONLCAYMPHDMBCE-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|