C10H13BrClN3O2 — CID 174657616
tert-butyl N-[(6-bromo-5-chloro-2-pyridinyl)amino]carbamate (PubChem CID 174657616) has the molecular formula C10H13BrClN3O2 and a molecular weight of 322.59 g/mol. Its IUPAC name is tert-butyl N-[(6-bromo-5-chloro-2-pyridinyl)amino]carbamate.
| Compound Name | tert-butyl N-[(6-bromo-5-chloro-2-pyridinyl)amino]carbamate |
|---|---|
| PubChem CID | 174657616 |
| Molecular Formula | C10H13BrClN3O2 |
| Molecular Weight | 322.59 g/mol |
| Exact Mass | 320.99 |
| IUPAC Name | tert-butyl N-[(6-bromo-5-chloro-2-pyridinyl)amino]carbamate |
| SMILES | CC(C)(C)OC(=O)NNc1ccc(Cl)c(Br)n1 |
| InChI | InChI=1S/C10H13BrClN3O2/c1-10(2,3)17-9(16)15-14-7-5-4-6(12)8(11)13-7/h4-5H,1-3H3,(H,13,14)(H,15,16) |
| InChIKey | ZOJYFSHHBUYTER-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.59 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|