C16H18ClFN4O3 — CID 170436054
tert-butyl N-[[5-amino-6-(2-chloro-5-fluorophenoxy)-2-pyridinyl]amino]carbamate (PubChem CID 170436054) has the molecular formula C16H18ClFN4O3 and a molecular weight of 368.80 g/mol. Its IUPAC name is tert-butyl N-[[5-amino-6-(2-chloro-5-fluorophenoxy)-2-pyridinyl]amino]carbamate.
| Compound Name | tert-butyl N-[[5-amino-6-(2-chloro-5-fluorophenoxy)-2-pyridinyl]amino]carbamate |
|---|---|
| PubChem CID | 170436054 |
| Molecular Formula | C16H18ClFN4O3 |
| Molecular Weight | 368.80 g/mol |
| Exact Mass | 368.11 |
| IUPAC Name | tert-butyl N-[[5-amino-6-(2-chloro-5-fluorophenoxy)-2-pyridinyl]amino]carbamate |
| SMILES | CC(C)(C)OC(=O)NNc1ccc(N)c(Oc2cc(F)ccc2Cl)n1 |
| InChI | InChI=1S/C16H18ClFN4O3/c1-16(2,3)25-15(23)22-21-13-7-6-11(19)14(20-13)24-12-8-9(18)4-5-10(12)17/h4-8H,19H2,1-3H3,(H,20,21)(H,22,23) |
| InChIKey | RNDQAPJQZYNQHX-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 98.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.80 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|