C13H19ClF3N3O2 — CID 177168278
tert-butyl N-[[6-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]carbamate;ethane (PubChem CID 177168278) has the molecular formula C13H19ClF3N3O2 and a molecular weight of 341.76 g/mol. Its IUPAC name is tert-butyl N-[[6-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]carbamate;ethane.
| Compound Name | tert-butyl N-[[6-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]carbamate;ethane |
|---|---|
| PubChem CID | 177168278 |
| Molecular Formula | C13H19ClF3N3O2 |
| Molecular Weight | 341.76 g/mol |
| Exact Mass | 341.11 |
| IUPAC Name | tert-butyl N-[[6-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]carbamate;ethane |
| SMILES | CC.CC(C)(C)OC(=O)NNc1ccc(C(F)(F)F)c(Cl)n1 |
| InChI | InChI=1S/C11H13ClF3N3O2.C2H6/c1-10(2,3)20-9(19)18-17-7-5-4-6(8(12)16-7)11(13,14)15;1-2/h4-5H,1-3H3,(H,16,17)(H,18,19);1-2H3 |
| InChIKey | QNBOIMBRSFHKRY-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.76 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|