C16H19ClF3N3O4 — CID 141225730
tert-butyl 3-[2-[[6-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]-5-methyl-1,3,2-dioxazol-4-yl]propanoate (PubChem CID 141225730) has the molecular formula C16H19ClF3N3O4 and a molecular weight of 409.79 g/mol. Its IUPAC name is tert-butyl 3-[2-[[6-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]-5-methyl-1,3,2-dioxazol-4-yl]propanoate.
| Compound Name | tert-butyl 3-[2-[[6-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]-5-methyl-1,3,2-dioxazol-4-yl]propanoate |
|---|---|
| PubChem CID | 141225730 |
| Molecular Formula | C16H19ClF3N3O4 |
| Molecular Weight | 409.79 g/mol |
| Exact Mass | 409.10 |
| IUPAC Name | tert-butyl 3-[2-[[6-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]-5-methyl-1,3,2-dioxazol-4-yl]propanoate |
| SMILES | CC1=C(CCC(=O)OC(C)(C)C)ON(Nc2ccc(C(F)(F)F)c(Cl)n2)O1 |
| InChI | InChI=1S/C16H19ClF3N3O4/c1-9-11(6-8-13(24)25-15(2,3)4)27-23(26-9)22-12-7-5-10(14(17)21-12)16(18,19)20/h5,7H,6,8H2,1-4H3,(H,21,22) |
| InChIKey | QGCWADLINVEDFB-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 72.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.79 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|