C10H7ClF3N3O — CID 177168003
1-[[6-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]-2H-pyrrol-5-one (PubChem CID 177168003) has the molecular formula C10H7ClF3N3O and a molecular weight of 277.63 g/mol. Its IUPAC name is 1-[[6-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]-2H-pyrrol-5-one.
| Compound Name | 1-[[6-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 177168003 |
| Molecular Formula | C10H7ClF3N3O |
| Molecular Weight | 277.63 g/mol |
| Exact Mass | 277.02 |
| IUPAC Name | 1-[[6-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]-2H-pyrrol-5-one |
| SMILES | O=C1C=CCN1Nc1ccc(C(F)(F)F)c(Cl)n1 |
| InChI | InChI=1S/C10H7ClF3N3O/c11-9-6(10(12,13)14)3-4-7(15-9)16-17-5-1-2-8(17)18/h1-4H,5H2,(H,15,16) |
| InChIKey | SRRAYJYSMHVVQQ-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.63 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|