C15H11ClF3N3O6 — CID 175879458
3-[[1-[[6-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]-4-methyl-2,5-dioxopyrrol-3-yl]methoxy]-3-oxopropanoic acid (PubChem CID 175879458) has the molecular formula C15H11ClF3N3O6 and a molecular weight of 421.72 g/mol. Its IUPAC name is 3-[[1-[[6-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]-4-methyl-2,5-dioxopyrrol-3-yl]methoxy]-3-oxopropanoic acid.
| Compound Name | 3-[[1-[[6-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]-4-methyl-2,5-dioxopyrrol-3-yl]methoxy]-3-oxopropanoic acid |
|---|---|
| PubChem CID | 175879458 |
| Molecular Formula | C15H11ClF3N3O6 |
| Molecular Weight | 421.72 g/mol |
| Exact Mass | 421.03 |
| IUPAC Name | 3-[[1-[[6-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]-4-methyl-2,5-dioxopyrrol-3-yl]methoxy]-3-oxopropanoic acid |
| SMILES | CC1=C(COC(=O)CC(=O)O)C(=O)N(Nc2ccc(C(F)(F)F)c(Cl)n2)C1=O |
| InChI | InChI=1S/C15H11ClF3N3O6/c1-6-7(5-28-11(25)4-10(23)24)14(27)22(13(6)26)21-9-3-2-8(12(16)20-9)15(17,18)19/h2-3H,4-5H2,1H3,(H,20,21)(H,23,24) |
| InChIKey | JYCZKYKLLCLXOG-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 125.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.72 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|