C15H13ClF3N3O4 — CID 87761434
3-[1-[[6-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]-4-methyl-2,5-dioxopyrrol-3-yl]-2-methylpropanoic acid (PubChem CID 87761434) has the molecular formula C15H13ClF3N3O4 and a molecular weight of 391.73 g/mol. Its IUPAC name is 3-[1-[[6-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]-4-methyl-2,5-dioxopyrrol-3-yl]-2-methylpropanoic acid.
| Compound Name | 3-[1-[[6-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]-4-methyl-2,5-dioxopyrrol-3-yl]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 87761434 |
| Molecular Formula | C15H13ClF3N3O4 |
| Molecular Weight | 391.73 g/mol |
| Exact Mass | 391.05 |
| IUPAC Name | 3-[1-[[6-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]-4-methyl-2,5-dioxopyrrol-3-yl]-2-methylpropanoic acid |
| SMILES | CC1=C(CC(C)C(=O)O)C(=O)N(Nc2ccc(C(F)(F)F)c(Cl)n2)C1=O |
| InChI | InChI=1S/C15H13ClF3N3O4/c1-6(14(25)26)5-8-7(2)12(23)22(13(8)24)21-10-4-3-9(11(16)20-10)15(17,18)19/h3-4,6H,5H2,1-2H3,(H,20,21)(H,25,26) |
| InChIKey | ASPXNDRALARZLC-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 99.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.73 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|