C19H19ClF3N3O6 — CID 136644841
diethyl 2-[[1-[[6-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]-2,5-dihydroxy-4-methylpyrrol-3-yl]methylidene]propanedioate (PubChem CID 136644841) has the molecular formula C19H19ClF3N3O6 and a molecular weight of 477.82 g/mol. Its IUPAC name is diethyl 2-[[1-[[6-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]-2,5-dihydroxy-4-methylpyrrol-3-yl]methylidene]propanedioate.
| Compound Name | diethyl 2-[[1-[[6-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]-2,5-dihydroxy-4-methylpyrrol-3-yl]methylidene]propanedioate |
|---|---|
| PubChem CID | 136644841 |
| Molecular Formula | C19H19ClF3N3O6 |
| Molecular Weight | 477.82 g/mol |
| Exact Mass | 477.09 |
| IUPAC Name | diethyl 2-[[1-[[6-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]-2,5-dihydroxy-4-methylpyrrol-3-yl]methylidene]propanedioate |
| SMILES | CCOC(=O)C(=Cc1c(C)c(O)n(Nc2ccc(C(F)(F)F)c(Cl)n2)c1O)C(=O)OCC |
| InChI | InChI=1S/C19H19ClF3N3O6/c1-4-31-17(29)11(18(30)32-5-2)8-10-9(3)15(27)26(16(10)28)25-13-7-6-12(14(20)24-13)19(21,22)23/h6-8,27-28H,4-5H2,1-3H3,(H,24,25) |
| InChIKey | VMJJWOUCWBUXBY-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 122.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.82 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|