C13H11ClF3N3O2 — CID 87263557
1-[[6-chloro-5-(trifluoromethyl)-2-pyridinyl]methylamino]-3,4-dimethylpyrrole-2,5-dione (PubChem CID 87263557) has the molecular formula C13H11ClF3N3O2 and a molecular weight of 333.70 g/mol. Its IUPAC name is 1-[[6-chloro-5-(trifluoromethyl)-2-pyridinyl]methylamino]-3,4-dimethylpyrrole-2,5-dione.
| Compound Name | 1-[[6-chloro-5-(trifluoromethyl)-2-pyridinyl]methylamino]-3,4-dimethylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 87263557 |
| Molecular Formula | C13H11ClF3N3O2 |
| Molecular Weight | 333.70 g/mol |
| Exact Mass | 333.05 |
| IUPAC Name | 1-[[6-chloro-5-(trifluoromethyl)-2-pyridinyl]methylamino]-3,4-dimethylpyrrole-2,5-dione |
| SMILES | CC1=C(C)C(=O)N(NCc2ccc(C(F)(F)F)c(Cl)n2)C1=O |
| InChI | InChI=1S/C13H11ClF3N3O2/c1-6-7(2)12(22)20(11(6)21)18-5-8-3-4-9(10(14)19-8)13(15,16)17/h3-4,18H,5H2,1-2H3 |
| InChIKey | HQEVBMMZKMQNSO-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.70 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|