C9H10ClF3N2O — CID 59300473
3-[[6-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]propan-1-ol (PubChem CID 59300473) has the molecular formula C9H10ClF3N2O and a molecular weight of 254.64 g/mol. Its IUPAC name is 3-[[6-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]propan-1-ol.
| Compound Name | 3-[[6-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]propan-1-ol |
|---|---|
| PubChem CID | 59300473 |
| Molecular Formula | C9H10ClF3N2O |
| Molecular Weight | 254.64 g/mol |
| Exact Mass | 254.04 |
| IUPAC Name | 3-[[6-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]propan-1-ol |
| SMILES | OCCCNc1ccc(C(F)(F)F)c(Cl)n1 |
| InChI | InChI=1S/C9H10ClF3N2O/c10-8-6(9(11,12)13)2-3-7(15-8)14-4-1-5-16/h2-3,16H,1,4-5H2,(H,14,15) |
| InChIKey | ZZQKYGYGFWBEOC-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.64 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|