C14H18F3NO5S — CID 86623615
tert-butyl 3-[6-methyl-5-(trifluoromethylsulfonyloxy)-2-pyridinyl]propanoate (PubChem CID 86623615) has the molecular formula C14H18F3NO5S and a molecular weight of 369.36 g/mol. Its IUPAC name is tert-butyl 3-[6-methyl-5-(trifluoromethylsulfonyloxy)-2-pyridinyl]propanoate.
| Compound Name | tert-butyl 3-[6-methyl-5-(trifluoromethylsulfonyloxy)-2-pyridinyl]propanoate |
|---|---|
| PubChem CID | 86623615 |
| Molecular Formula | C14H18F3NO5S |
| Molecular Weight | 369.36 g/mol |
| Exact Mass | 369.09 |
| IUPAC Name | tert-butyl 3-[6-methyl-5-(trifluoromethylsulfonyloxy)-2-pyridinyl]propanoate |
| SMILES | Cc1nc(CCC(=O)OC(C)(C)C)ccc1OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C14H18F3NO5S/c1-9-11(23-24(20,21)14(15,16)17)7-5-10(18-9)6-8-12(19)22-13(2,3)4/h5,7H,6,8H2,1-4H3 |
| InChIKey | VORQFMWJZGRJLD-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 82.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.36 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|