C14H10F6N2O6S2 — CID 11092040
[6-methyl-2-[6-methyl-3-(trifluoromethylsulfonyloxy)-2-pyridinyl]-3-pyridinyl] trifluoromethanesulfonate (PubChem CID 11092040) has the molecular formula C14H10F6N2O6S2 and a molecular weight of 480.36 g/mol. Its IUPAC name is [6-methyl-2-[6-methyl-3-(trifluoromethylsulfonyloxy)-2-pyridinyl]-3-pyridinyl] trifluoromethanesulfonate.
| Compound Name | [6-methyl-2-[6-methyl-3-(trifluoromethylsulfonyloxy)-2-pyridinyl]-3-pyridinyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 11092040 |
| Molecular Formula | C14H10F6N2O6S2 |
| Molecular Weight | 480.36 g/mol |
| Exact Mass | 479.99 |
| IUPAC Name | [6-methyl-2-[6-methyl-3-(trifluoromethylsulfonyloxy)-2-pyridinyl]-3-pyridinyl] trifluoromethanesulfonate |
| SMILES | Cc1ccc(OS(=O)(=O)C(F)(F)F)c(-c2nc(C)ccc2OS(=O)(=O)C(F)(F)F)n1 |
| InChI | InChI=1S/C14H10F6N2O6S2/c1-7-3-5-9(27-29(23,24)13(15,16)17)11(21-7)12-10(6-4-8(2)22-12)28-30(25,26)14(18,19)20/h3-6H,1-2H3 |
| InChIKey | XBMVONKEGBPKAQ-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 112.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.36 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|