methyl 6-bromo-3-oxo-1,2-dihydroindene-2-carboxylate

C11H9BrO3 — CID 23158180

IUPACmethyl 6-bromo-3-oxo-1,2-dihydroindene-2-carboxylate
SMILESCOC(=O)C1Cc2cc(Br)ccc2C1=O
InChIInChI=1S/C11H9BrO3/c1-15-11(14)9-5-6-4-7(12)2-3-8(6)10(9)13/h2-4,9H,5H2,1H3
InChIKeyHJYFQVWOJMRKDU-UHFFFAOYSA-N
MW269.09 g/mol
LogP1.98
Rot. Bonds1

About methyl 6-bromo-3-oxo-1,2-dihydroindene-2-carboxylate

methyl 6-bromo-3-oxo-1,2-dihydroindene-2-carboxylate (PubChem CID 23158180) has the molecular formula C11H9BrO3 and a molecular weight of 269.09 g/mol. Its IUPAC name is methyl 6-bromo-3-oxo-1,2-dihydroindene-2-carboxylate.

Molecular Properties

Compound Namemethyl 6-bromo-3-oxo-1,2-dihydroindene-2-carboxylate
PubChem CID23158180
Molecular FormulaC11H9BrO3
Molecular Weight269.09 g/mol
Exact Mass267.97
IUPAC Namemethyl 6-bromo-3-oxo-1,2-dihydroindene-2-carboxylate
SMILESCOC(=O)C1Cc2cc(Br)ccc2C1=O
InChIInChI=1S/C11H9BrO3/c1-15-11(14)9-5-6-4-7(12)2-3-8(6)10(9)13/h2-4,9H,5H2,1H3
InChIKeyHJYFQVWOJMRKDU-UHFFFAOYSA-N
XLogP1.98
TPSA43.37 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500269.09
LogP ≤ 51.98
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}

Analyze methyl 6-bromo-3-oxo-1,2-dihydroindene-2-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 6-bromo-3-oxo-1,2-dihydroindene-2-carboxylate?
The IUPAC name of methyl 6-bromo-3-oxo-1,2-dihydroindene-2-carboxylate (CID 23158180) is methyl 6-bromo-3-oxo-1,2-dihydroindene-2-carboxylate.
What is the SMILES notation for methyl 6-bromo-3-oxo-1,2-dihydroindene-2-carboxylate?
The canonical SMILES for methyl 6-bromo-3-oxo-1,2-dihydroindene-2-carboxylate is COC(=O)C1Cc2cc(Br)ccc2C1=O.
What is the InChIKey of methyl 6-bromo-3-oxo-1,2-dihydroindene-2-carboxylate?
The InChIKey is HJYFQVWOJMRKDU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9BrO3/c1-15-11(14)9-5-6-4-7(12)2-3-8(6)10(9)13/h2-4,9H,5H2,1H3.
What are the key properties of methyl 6-bromo-3-oxo-1,2-dihydroindene-2-carboxylate?
methyl 6-bromo-3-oxo-1,2-dihydroindene-2-carboxylate has a molecular weight of 269.09 g/mol, XLogP of 1.98, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 6-bromo-3-oxo-1,2-dihydroindene-2-carboxylate is sourced from PubChem (CID 23158180), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).