C11H9BrO3 — CID 23158180
methyl 6-bromo-3-oxo-1,2-dihydroindene-2-carboxylate (PubChem CID 23158180) has the molecular formula C11H9BrO3 and a molecular weight of 269.09 g/mol. Its IUPAC name is methyl 6-bromo-3-oxo-1,2-dihydroindene-2-carboxylate.
| Compound Name | methyl 6-bromo-3-oxo-1,2-dihydroindene-2-carboxylate |
|---|---|
| PubChem CID | 23158180 |
| Molecular Formula | C11H9BrO3 |
| Molecular Weight | 269.09 g/mol |
| Exact Mass | 267.97 |
| IUPAC Name | methyl 6-bromo-3-oxo-1,2-dihydroindene-2-carboxylate |
| SMILES | COC(=O)C1Cc2cc(Br)ccc2C1=O |
| InChI | InChI=1S/C11H9BrO3/c1-15-11(14)9-5-6-4-7(12)2-3-8(6)10(9)13/h2-4,9H,5H2,1H3 |
| InChIKey | HJYFQVWOJMRKDU-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.09 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|