C13H12BrNO4 — CID 1491703
methyl (3S,6S)-6-(4-bromophenyl)-2,4-dioxopiperidine-3-carboxylate (PubChem CID 1491703) has the molecular formula C13H12BrNO4 and a molecular weight of 326.15 g/mol. Its IUPAC name is methyl (3S,6S)-6-(4-bromophenyl)-2,4-dioxopiperidine-3-carboxylate.
| Compound Name | methyl (3S,6S)-6-(4-bromophenyl)-2,4-dioxopiperidine-3-carboxylate |
|---|---|
| PubChem CID | 1491703 |
| Molecular Formula | C13H12BrNO4 |
| Molecular Weight | 326.15 g/mol |
| Exact Mass | 324.99 |
| IUPAC Name | methyl (3S,6S)-6-(4-bromophenyl)-2,4-dioxopiperidine-3-carboxylate |
| SMILES | COC(=O)[C@H]1C(=O)C[C@@H](c2ccc(Br)cc2)NC1=O |
| InChI | InChI=1S/C13H12BrNO4/c1-19-13(18)11-10(16)6-9(15-12(11)17)7-2-4-8(14)5-3-7/h2-5,9,11H,6H2,1H3,(H,15,17)/t9-,11-/m0/s1 |
| InChIKey | BAWHBUXVKJEXAW-ONGXEEELSA-N |
| XLogP | 1.37 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.15 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|