C15H16BrNO3 — CID 102039177
methyl (1R,3S,3aR,6aS)-1-(4-bromophenyl)-6-oxo-2,3,3a,4,5,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxylate (PubChem CID 102039177) has the molecular formula C15H16BrNO3 and a molecular weight of 338.20 g/mol. Its IUPAC name is methyl (1R,3S,3aR,6aS)-1-(4-bromophenyl)-6-oxo-2,3,3a,4,5,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxylate.
| Compound Name | methyl (1R,3S,3aR,6aS)-1-(4-bromophenyl)-6-oxo-2,3,3a,4,5,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 102039177 |
| Molecular Formula | C15H16BrNO3 |
| Molecular Weight | 338.20 g/mol |
| Exact Mass | 337.03 |
| IUPAC Name | methyl (1R,3S,3aR,6aS)-1-(4-bromophenyl)-6-oxo-2,3,3a,4,5,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxylate |
| SMILES | COC(=O)[C@H]1N[C@@H](c2ccc(Br)cc2)[C@H]2C(=O)CC[C@H]21 |
| InChI | InChI=1S/C15H16BrNO3/c1-20-15(19)14-10-6-7-11(18)12(10)13(17-14)8-2-4-9(16)5-3-8/h2-5,10,12-14,17H,6-7H2,1H3/t10-,12-,13+,14+/m1/s1 |
| InChIKey | DFQDGAGWJMIZKQ-ZZVYKPCYSA-N |
| XLogP | 2.23 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.20 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |