C18H20FNO7 — CID 72793138
methyl (1R,3S,3aR,4R,7aS)-1-(4-fluorophenyl)-4-(2-methoxyacetyl)oxy-7-oxo-1,2,3,3a,4,7a-hexahydropyrano[3,4-c]pyrrole-3-carboxylate (PubChem CID 72793138) has the molecular formula C18H20FNO7 and a molecular weight of 381.36 g/mol. Its IUPAC name is methyl (1R,3S,3aR,4R,7aS)-1-(4-fluorophenyl)-4-(2-methoxyacetyl)oxy-7-oxo-1,2,3,3a,4,7a-hexahydropyrano[3,4-c]pyrrole-3-carboxylate.
| Compound Name | methyl (1R,3S,3aR,4R,7aS)-1-(4-fluorophenyl)-4-(2-methoxyacetyl)oxy-7-oxo-1,2,3,3a,4,7a-hexahydropyrano[3,4-c]pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 72793138 |
| Molecular Formula | C18H20FNO7 |
| Molecular Weight | 381.36 g/mol |
| Exact Mass | 381.12 |
| IUPAC Name | methyl (1R,3S,3aR,4R,7aS)-1-(4-fluorophenyl)-4-(2-methoxyacetyl)oxy-7-oxo-1,2,3,3a,4,7a-hexahydropyrano[3,4-c]pyrrole-3-carboxylate |
| SMILES | COCC(=O)O[C@H]1OCC(=O)[C@H]2[C@@H]1[C@@H](C(=O)OC)N[C@H]2c1ccc(F)cc1 |
| InChI | InChI=1S/C18H20FNO7/c1-24-8-12(22)27-18-14-13(11(21)7-26-18)15(20-16(14)17(23)25-2)9-3-5-10(19)6-4-9/h3-6,13-16,18,20H,7-8H2,1-2H3/t13-,14+,15-,16-,18+/m0/s1 |
| InChIKey | IEUSSOHVJLYGLB-ULQWZQFMSA-N |
| XLogP | 0.36 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.36 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |