C10H12FN3O2 — CID 77212993
methyl 5-(4-fluorophenyl)triazolidine-4-carboxylate (PubChem CID 77212993) has the molecular formula C10H12FN3O2 and a molecular weight of 225.22 g/mol. Its IUPAC name is methyl 5-(4-fluorophenyl)triazolidine-4-carboxylate.
| Compound Name | methyl 5-(4-fluorophenyl)triazolidine-4-carboxylate |
|---|---|
| PubChem CID | 77212993 |
| Molecular Formula | C10H12FN3O2 |
| Molecular Weight | 225.22 g/mol |
| Exact Mass | 225.09 |
| IUPAC Name | methyl 5-(4-fluorophenyl)triazolidine-4-carboxylate |
| SMILES | COC(=O)C1NNNC1c1ccc(F)cc1 |
| InChI | InChI=1S/C10H12FN3O2/c1-16-10(15)9-8(12-14-13-9)6-2-4-7(11)5-3-6/h2-5,8-9,12-14H,1H3 |
| InChIKey | WLPIFEVCXUXODN-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.22 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |