C18H15F2NO3 — CID 146164336
methyl (1R)-6-fluoro-1-(4-fluorophenyl)-2-methyl-3-oxo-1,4-dihydroisoquinoline-4-carboxylate (PubChem CID 146164336) has the molecular formula C18H15F2NO3 and a molecular weight of 331.32 g/mol. Its IUPAC name is methyl (1R)-6-fluoro-1-(4-fluorophenyl)-2-methyl-3-oxo-1,4-dihydroisoquinoline-4-carboxylate.
| Compound Name | methyl (1R)-6-fluoro-1-(4-fluorophenyl)-2-methyl-3-oxo-1,4-dihydroisoquinoline-4-carboxylate |
|---|---|
| PubChem CID | 146164336 |
| Molecular Formula | C18H15F2NO3 |
| Molecular Weight | 331.32 g/mol |
| Exact Mass | 331.10 |
| IUPAC Name | methyl (1R)-6-fluoro-1-(4-fluorophenyl)-2-methyl-3-oxo-1,4-dihydroisoquinoline-4-carboxylate |
| SMILES | COC(=O)C1C(=O)N(C)[C@H](c2ccc(F)cc2)c2ccc(F)cc21 |
| InChI | InChI=1S/C18H15F2NO3/c1-21-16(10-3-5-11(19)6-4-10)13-8-7-12(20)9-14(13)15(17(21)22)18(23)24-2/h3-9,15-16H,1-2H3/t15?,16-/m1/s1 |
| InChIKey | DFIUUWOJYDTHFF-OEMAIJDKSA-N |
| XLogP | 2.78 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.32 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|