C15H12FNO — CID 132524924
3-(4-fluorophenyl)-2-methyl-3H-isoindol-1-one (PubChem CID 132524924) has the molecular formula C15H12FNO and a molecular weight of 241.27 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-2-methyl-3H-isoindol-1-one.
| Compound Name | 3-(4-fluorophenyl)-2-methyl-3H-isoindol-1-one |
|---|---|
| PubChem CID | 132524924 |
| Molecular Formula | C15H12FNO |
| Molecular Weight | 241.27 g/mol |
| Exact Mass | 241.09 |
| IUPAC Name | 3-(4-fluorophenyl)-2-methyl-3H-isoindol-1-one |
| SMILES | CN1C(=O)c2ccccc2C1c1ccc(F)cc1 |
| InChI | InChI=1S/C15H12FNO/c1-17-14(10-6-8-11(16)9-7-10)12-4-2-3-5-13(12)15(17)18/h2-9,14H,1H3 |
| InChIKey | MGJJEPQTRGZIQW-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.27 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |