C24H17FN2O — CID 7094450
(2S,12R)-12-(4-fluorophenyl)-10,20-diazapentacyclo[11.7.0.02,10.03,8.014,19]icosa-1(13),3,5,7,14,16,18-heptaen-9-one (PubChem CID 7094450) has the molecular formula C24H17FN2O and a molecular weight of 368.41 g/mol. Its IUPAC name is (2S,12R)-12-(4-fluorophenyl)-10,20-diazapentacyclo[11.7.0.02,10.03,8.014,19]icosa-1(13),3,5,7,14,16,18-heptaen-9-one.
| Compound Name | (2S,12R)-12-(4-fluorophenyl)-10,20-diazapentacyclo[11.7.0.02,10.03,8.014,19]icosa-1(13),3,5,7,14,16,18-heptaen-9-one |
|---|---|
| PubChem CID | 7094450 |
| Molecular Formula | C24H17FN2O |
| Molecular Weight | 368.41 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | (2S,12R)-12-(4-fluorophenyl)-10,20-diazapentacyclo[11.7.0.02,10.03,8.014,19]icosa-1(13),3,5,7,14,16,18-heptaen-9-one |
| SMILES | O=C1c2ccccc2[C@H]2c3[nH]c4ccccc4c3[C@@H](c3ccc(F)cc3)CN12 |
| InChI | InChI=1S/C24H17FN2O/c25-15-11-9-14(10-12-15)19-13-27-23(16-5-1-2-6-17(16)24(27)28)22-21(19)18-7-3-4-8-20(18)26-22/h1-12,19,23,26H,13H2/t19-,23+/m1/s1 |
| InChIKey | RZECRGIQWCIZHU-XXBNENTESA-N |
| XLogP | 5.00 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.41 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|