C19H14N2O3 — CID 3602824
9-oxo-10,20-diazapentacyclo[11.7.0.02,10.03,8.014,19]icosa-1(13),3,5,7,14,16,18-heptaene-11-carboxylic acid (PubChem CID 3602824) has the molecular formula C19H14N2O3 and a molecular weight of 318.33 g/mol. Its IUPAC name is 9-oxo-10,20-diazapentacyclo[11.7.0.02,10.03,8.014,19]icosa-1(13),3,5,7,14,16,18-heptaene-11-carboxylic acid.
| Compound Name | 9-oxo-10,20-diazapentacyclo[11.7.0.02,10.03,8.014,19]icosa-1(13),3,5,7,14,16,18-heptaene-11-carboxylic acid |
|---|---|
| PubChem CID | 3602824 |
| Molecular Formula | C19H14N2O3 |
| Molecular Weight | 318.33 g/mol |
| Exact Mass | 318.10 |
| IUPAC Name | 9-oxo-10,20-diazapentacyclo[11.7.0.02,10.03,8.014,19]icosa-1(13),3,5,7,14,16,18-heptaene-11-carboxylic acid |
| SMILES | O=C(O)C1Cc2c([nH]c3ccccc23)C2c3ccccc3C(=O)N12 |
| InChI | InChI=1S/C19H14N2O3/c22-18-12-7-2-1-6-11(12)17-16-13(9-15(19(23)24)21(17)18)10-5-3-4-8-14(10)20-16/h1-8,15,17,20H,9H2,(H,23,24) |
| InChIKey | NMSSNEBLDWGZIO-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 73.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.33 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|