C27H21N3O4 — CID 4838975
N-(1,3-benzodioxol-5-ylmethyl)-9-oxo-10,20-diazapentacyclo[11.7.0.02,10.03,8.014,19]icosa-1(13),3,5,7,14,16,18-heptaene-11-carboxamide (PubChem CID 4838975) has the molecular formula C27H21N3O4 and a molecular weight of 451.48 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-9-oxo-10,20-diazapentacyclo[11.7.0.02,10.03,8.014,19]icosa-1(13),3,5,7,14,16,18-heptaene-11-carboxamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-9-oxo-10,20-diazapentacyclo[11.7.0.02,10.03,8.014,19]icosa-1(13),3,5,7,14,16,18-heptaene-11-carboxamide |
|---|---|
| PubChem CID | 4838975 |
| Molecular Formula | C27H21N3O4 |
| Molecular Weight | 451.48 g/mol |
| Exact Mass | 451.15 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-9-oxo-10,20-diazapentacyclo[11.7.0.02,10.03,8.014,19]icosa-1(13),3,5,7,14,16,18-heptaene-11-carboxamide |
| SMILES | O=C(NCc1ccc2c(c1)OCO2)C1Cc2c([nH]c3ccccc23)C2c3ccccc3C(=O)N12 |
| InChI | InChI=1S/C27H21N3O4/c31-26(28-13-15-9-10-22-23(11-15)34-14-33-22)21-12-19-16-5-3-4-8-20(16)29-24(19)25-17-6-1-2-7-18(17)27(32)30(21)25/h1-11,21,25,29H,12-14H2,(H,28,31) |
| InChIKey | SUHGKOAJSWFQHX-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 83.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.48 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|