C32H32N4O4 — CID 124648250
(2R,11R)-N-[(2R)-1-[(3-methoxyphenyl)methylamino]-3-methyl-1-oxobutan-2-yl]-9-oxo-10,20-diazapentacyclo[11.7.0.02,10.03,8.014,19]icosa-1(13),3,5,7,14,16,18-heptaene-11-carboxamide (PubChem CID 124648250) has the molecular formula C32H32N4O4 and a molecular weight of 536.63 g/mol. Its IUPAC name is (2R,11R)-N-[(2R)-1-[(3-methoxyphenyl)methylamino]-3-methyl-1-oxobutan-2-yl]-9-oxo-10,20-diazapentacyclo[11.7.0.02,10.03,8.014,19]icosa-1(13),3,5,7,14,16,18-heptaene-11-carboxamide.
| Compound Name | (2R,11R)-N-[(2R)-1-[(3-methoxyphenyl)methylamino]-3-methyl-1-oxobutan-2-yl]-9-oxo-10,20-diazapentacyclo[11.7.0.02,10.03,8.014,19]icosa-1(13),3,5,7,14,16,18-heptaene-11-carboxamide |
|---|---|
| PubChem CID | 124648250 |
| Molecular Formula | C32H32N4O4 |
| Molecular Weight | 536.63 g/mol |
| Exact Mass | 536.24 |
| IUPAC Name | (2R,11R)-N-[(2R)-1-[(3-methoxyphenyl)methylamino]-3-methyl-1-oxobutan-2-yl]-9-oxo-10,20-diazapentacyclo[11.7.0.02,10.03,8.014,19]icosa-1(13),3,5,7,14,16,18-heptaene-11-carboxamide |
| SMILES | COc1cccc(CNC(=O)[C@H](NC(=O)[C@H]2Cc3c([nH]c4ccccc34)[C@H]3c4ccccc4C(=O)N32)C(C)C)c1 |
| InChI | InChI=1S/C32H32N4O4/c1-18(2)27(31(38)33-17-19-9-8-10-20(15-19)40-3)35-30(37)26-16-24-21-11-6-7-14-25(21)34-28(24)29-22-12-4-5-13-23(22)32(39)36(26)29/h4-15,18,26-27,29,34H,16-17H2,1-3H3,(H,33,38)(H,35,37)/t26-,27-,29-/m1/s1 |
| InChIKey | JCELTDPSVINWFF-LSMIHOHGSA-N |
| XLogP | 4.10 |
| TPSA | 103.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.63 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|