C31H30N4O3S — CID 95373689
(2R,11S)-N-[(2S)-1-(benzylamino)-4-methylsulfanyl-1-oxobutan-2-yl]-9-oxo-10,20-diazapentacyclo[11.7.0.02,10.03,8.014,19]icosa-1(13),3,5,7,14,16,18-heptaene-11-carboxamide (PubChem CID 95373689) has the molecular formula C31H30N4O3S and a molecular weight of 538.67 g/mol. Its IUPAC name is (2R,11S)-N-[(2S)-1-(benzylamino)-4-methylsulfanyl-1-oxobutan-2-yl]-9-oxo-10,20-diazapentacyclo[11.7.0.02,10.03,8.014,19]icosa-1(13),3,5,7,14,16,18-heptaene-11-carboxamide.
| Compound Name | (2R,11S)-N-[(2S)-1-(benzylamino)-4-methylsulfanyl-1-oxobutan-2-yl]-9-oxo-10,20-diazapentacyclo[11.7.0.02,10.03,8.014,19]icosa-1(13),3,5,7,14,16,18-heptaene-11-carboxamide |
|---|---|
| PubChem CID | 95373689 |
| Molecular Formula | C31H30N4O3S |
| Molecular Weight | 538.67 g/mol |
| Exact Mass | 538.20 |
| IUPAC Name | (2R,11S)-N-[(2S)-1-(benzylamino)-4-methylsulfanyl-1-oxobutan-2-yl]-9-oxo-10,20-diazapentacyclo[11.7.0.02,10.03,8.014,19]icosa-1(13),3,5,7,14,16,18-heptaene-11-carboxamide |
| SMILES | CSCC[C@H](NC(=O)[C@@H]1Cc2c([nH]c3ccccc23)[C@H]2c3ccccc3C(=O)N21)C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C31H30N4O3S/c1-39-16-15-25(29(36)32-18-19-9-3-2-4-10-19)34-30(37)26-17-23-20-11-7-8-14-24(20)33-27(23)28-21-12-5-6-13-22(21)31(38)35(26)28/h2-14,25-26,28,33H,15-18H2,1H3,(H,32,36)(H,34,37)/t25-,26-,28+/m0/s1 |
| InChIKey | QSHBITULIXIKGP-UNCTUWKVSA-N |
| XLogP | 4.19 |
| TPSA | 94.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.67 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|