C33H32N4O4 — CID 95373598
(2S,11S)-9-oxo-N-[(2S)-1-oxo-1-[[(2S)-oxolan-2-yl]methylamino]-3-phenylpropan-2-yl]-10,20-diazapentacyclo[11.7.0.02,10.03,8.014,19]icosa-1(13),3,5,7,14,16,18-heptaene-11-carboxamide (PubChem CID 95373598) has the molecular formula C33H32N4O4 and a molecular weight of 548.64 g/mol. Its IUPAC name is (2S,11S)-9-oxo-N-[(2S)-1-oxo-1-[[(2S)-oxolan-2-yl]methylamino]-3-phenylpropan-2-yl]-10,20-diazapentacyclo[11.7.0.02,10.03,8.014,19]icosa-1(13),3,5,7,14,16,18-heptaene-11-carboxamide.
| Compound Name | (2S,11S)-9-oxo-N-[(2S)-1-oxo-1-[[(2S)-oxolan-2-yl]methylamino]-3-phenylpropan-2-yl]-10,20-diazapentacyclo[11.7.0.02,10.03,8.014,19]icosa-1(13),3,5,7,14,16,18-heptaene-11-carboxamide |
|---|---|
| PubChem CID | 95373598 |
| Molecular Formula | C33H32N4O4 |
| Molecular Weight | 548.64 g/mol |
| Exact Mass | 548.24 |
| IUPAC Name | (2S,11S)-9-oxo-N-[(2S)-1-oxo-1-[[(2S)-oxolan-2-yl]methylamino]-3-phenylpropan-2-yl]-10,20-diazapentacyclo[11.7.0.02,10.03,8.014,19]icosa-1(13),3,5,7,14,16,18-heptaene-11-carboxamide |
| SMILES | O=C(NC[C@@H]1CCCO1)[C@H](Cc1ccccc1)NC(=O)[C@@H]1Cc2c([nH]c3ccccc23)[C@@H]2c3ccccc3C(=O)N21 |
| InChI | InChI=1S/C33H32N4O4/c38-31(34-19-21-11-8-16-41-21)27(17-20-9-2-1-3-10-20)36-32(39)28-18-25-22-12-6-7-15-26(22)35-29(25)30-23-13-4-5-14-24(23)33(40)37(28)30/h1-7,9-10,12-15,21,27-28,30,35H,8,11,16-19H2,(H,34,38)(H,36,39)/t21-,27-,28-,30-/m0/s1 |
| InChIKey | VLZHGHUMPZNFMC-BGCOULCTSA-N |
| XLogP | 3.66 |
| TPSA | 103.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.64 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|