C29H32N4O4S — CID 93472923
(2S,11S)-N-[(2S)-4-methylsulfanyl-1-oxo-1-[[(2S)-oxolan-2-yl]methylamino]butan-2-yl]-9-oxo-10,20-diazapentacyclo[11.7.0.02,10.03,8.014,19]icosa-1(13),3,5,7,14,16,18-heptaene-11-carboxamide (PubChem CID 93472923) has the molecular formula C29H32N4O4S and a molecular weight of 532.67 g/mol. Its IUPAC name is (2S,11S)-N-[(2S)-4-methylsulfanyl-1-oxo-1-[[(2S)-oxolan-2-yl]methylamino]butan-2-yl]-9-oxo-10,20-diazapentacyclo[11.7.0.02,10.03,8.014,19]icosa-1(13),3,5,7,14,16,18-heptaene-11-carboxamide.
| Compound Name | (2S,11S)-N-[(2S)-4-methylsulfanyl-1-oxo-1-[[(2S)-oxolan-2-yl]methylamino]butan-2-yl]-9-oxo-10,20-diazapentacyclo[11.7.0.02,10.03,8.014,19]icosa-1(13),3,5,7,14,16,18-heptaene-11-carboxamide |
|---|---|
| PubChem CID | 93472923 |
| Molecular Formula | C29H32N4O4S |
| Molecular Weight | 532.67 g/mol |
| Exact Mass | 532.21 |
| IUPAC Name | (2S,11S)-N-[(2S)-4-methylsulfanyl-1-oxo-1-[[(2S)-oxolan-2-yl]methylamino]butan-2-yl]-9-oxo-10,20-diazapentacyclo[11.7.0.02,10.03,8.014,19]icosa-1(13),3,5,7,14,16,18-heptaene-11-carboxamide |
| SMILES | CSCC[C@H](NC(=O)[C@@H]1Cc2c([nH]c3ccccc23)[C@@H]2c3ccccc3C(=O)N21)C(=O)NC[C@@H]1CCCO1 |
| InChI | InChI=1S/C29H32N4O4S/c1-38-14-12-23(27(34)30-16-17-7-6-13-37-17)32-28(35)24-15-21-18-8-4-5-11-22(18)31-25(21)26-19-9-2-3-10-20(19)29(36)33(24)26/h2-5,8-11,17,23-24,26,31H,6-7,12-16H2,1H3,(H,30,34)(H,32,35)/t17-,23-,24-,26-/m0/s1 |
| InChIKey | VFAWLHPUAWSITG-WRSRFLKKSA-N |
| XLogP | 3.17 |
| TPSA | 103.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.67 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|