C30H36N4O3S — CID 40853434
(2S,11S)-N-[(2S)-1-(hexylamino)-4-methylsulfanyl-1-oxobutan-2-yl]-9-oxo-10,20-diazapentacyclo[11.7.0.02,10.03,8.014,19]icosa-1(13),3,5,7,14,16,18-heptaene-11-carboxamide (PubChem CID 40853434) has the molecular formula C30H36N4O3S and a molecular weight of 532.71 g/mol. Its IUPAC name is (2S,11S)-N-[(2S)-1-(hexylamino)-4-methylsulfanyl-1-oxobutan-2-yl]-9-oxo-10,20-diazapentacyclo[11.7.0.02,10.03,8.014,19]icosa-1(13),3,5,7,14,16,18-heptaene-11-carboxamide.
| Compound Name | (2S,11S)-N-[(2S)-1-(hexylamino)-4-methylsulfanyl-1-oxobutan-2-yl]-9-oxo-10,20-diazapentacyclo[11.7.0.02,10.03,8.014,19]icosa-1(13),3,5,7,14,16,18-heptaene-11-carboxamide |
|---|---|
| PubChem CID | 40853434 |
| Molecular Formula | C30H36N4O3S |
| Molecular Weight | 532.71 g/mol |
| Exact Mass | 532.25 |
| IUPAC Name | (2S,11S)-N-[(2S)-1-(hexylamino)-4-methylsulfanyl-1-oxobutan-2-yl]-9-oxo-10,20-diazapentacyclo[11.7.0.02,10.03,8.014,19]icosa-1(13),3,5,7,14,16,18-heptaene-11-carboxamide |
| SMILES | CCCCCCNC(=O)[C@H](CCSC)NC(=O)[C@@H]1Cc2c([nH]c3ccccc23)[C@@H]2c3ccccc3C(=O)N21 |
| InChI | InChI=1S/C30H36N4O3S/c1-3-4-5-10-16-31-28(35)24(15-17-38-2)33-29(36)25-18-22-19-11-8-9-14-23(19)32-26(22)27-20-12-6-7-13-21(20)30(37)34(25)27/h6-9,11-14,24-25,27,32H,3-5,10,15-18H2,1-2H3,(H,31,35)(H,33,36)/t24-,25-,27-/m0/s1 |
| InChIKey | YHMQTQSVEOMQTG-KLJDGLGGSA-N |
| XLogP | 4.57 |
| TPSA | 94.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.71 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|