C25H18N2O3 — CID 7094504
(2S,12S)-12-(1,3-benzodioxol-5-yl)-10,20-diazapentacyclo[11.7.0.02,10.03,8.014,19]icosa-1(13),3,5,7,14,16,18-heptaen-9-one (PubChem CID 7094504) has the molecular formula C25H18N2O3 and a molecular weight of 394.43 g/mol. Its IUPAC name is (2S,12S)-12-(1,3-benzodioxol-5-yl)-10,20-diazapentacyclo[11.7.0.02,10.03,8.014,19]icosa-1(13),3,5,7,14,16,18-heptaen-9-one.
| Compound Name | (2S,12S)-12-(1,3-benzodioxol-5-yl)-10,20-diazapentacyclo[11.7.0.02,10.03,8.014,19]icosa-1(13),3,5,7,14,16,18-heptaen-9-one |
|---|---|
| PubChem CID | 7094504 |
| Molecular Formula | C25H18N2O3 |
| Molecular Weight | 394.43 g/mol |
| Exact Mass | 394.13 |
| IUPAC Name | (2S,12S)-12-(1,3-benzodioxol-5-yl)-10,20-diazapentacyclo[11.7.0.02,10.03,8.014,19]icosa-1(13),3,5,7,14,16,18-heptaen-9-one |
| SMILES | O=C1c2ccccc2[C@H]2c3[nH]c4ccccc4c3[C@H](c3ccc4c(c3)OCO4)CN12 |
| InChI | InChI=1S/C25H18N2O3/c28-25-16-6-2-1-5-15(16)24-23-22(17-7-3-4-8-19(17)26-23)18(12-27(24)25)14-9-10-20-21(11-14)30-13-29-20/h1-11,18,24,26H,12-13H2/t18-,24-/m0/s1 |
| InChIKey | NPLQAJWRJOQYGL-UUOWRZLLSA-N |
| XLogP | 4.59 |
| TPSA | 54.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.43 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|