C24H22N4O4 — CID 59120509
(1R,12R)-17-amino-12-(1,3-benzodioxol-5-yl)-10,13,19-triazapentacyclo[11.7.0.03,11.04,9.015,19]icosa-3(11),4,6,8-tetraene-14,20-dione (PubChem CID 59120509) has the molecular formula C24H22N4O4 and a molecular weight of 430.46 g/mol. Its IUPAC name is (1R,12R)-17-amino-12-(1,3-benzodioxol-5-yl)-10,13,19-triazapentacyclo[11.7.0.03,11.04,9.015,19]icosa-3(11),4,6,8-tetraene-14,20-dione.
| Compound Name | (1R,12R)-17-amino-12-(1,3-benzodioxol-5-yl)-10,13,19-triazapentacyclo[11.7.0.03,11.04,9.015,19]icosa-3(11),4,6,8-tetraene-14,20-dione |
|---|---|
| PubChem CID | 59120509 |
| Molecular Formula | C24H22N4O4 |
| Molecular Weight | 430.46 g/mol |
| Exact Mass | 430.16 |
| IUPAC Name | (1R,12R)-17-amino-12-(1,3-benzodioxol-5-yl)-10,13,19-triazapentacyclo[11.7.0.03,11.04,9.015,19]icosa-3(11),4,6,8-tetraene-14,20-dione |
| SMILES | NC1CC2C(=O)N3[C@H](c4ccc5c(c4)OCO5)c4[nH]c5ccccc5c4C[C@@H]3C(=O)N2C1 |
| InChI | InChI=1S/C24H22N4O4/c25-13-8-17-24(30)28-18(23(29)27(17)10-13)9-15-14-3-1-2-4-16(14)26-21(15)22(28)12-5-6-19-20(7-12)32-11-31-19/h1-7,13,17-18,22,26H,8-11,25H2/t13?,17?,18-,22-/m1/s1 |
| InChIKey | JFGCBTJFLSNMGU-WXYIOAEISA-N |
| XLogP | 1.68 |
| TPSA | 100.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.46 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|