C37H40N4O8 — CID 24954393
(2R,8R)-2-(1,3-benzodioxol-5-yl)-6-[1-[[3,4-bis(2-methoxyethoxy)phenyl]methyl]azetidin-3-yl]-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione (PubChem CID 24954393) has the molecular formula C37H40N4O8 and a molecular weight of 668.75 g/mol. Its IUPAC name is (2R,8R)-2-(1,3-benzodioxol-5-yl)-6-[1-[[3,4-bis(2-methoxyethoxy)phenyl]methyl]azetidin-3-yl]-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione.
| Compound Name | (2R,8R)-2-(1,3-benzodioxol-5-yl)-6-[1-[[3,4-bis(2-methoxyethoxy)phenyl]methyl]azetidin-3-yl]-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione |
|---|---|
| PubChem CID | 24954393 |
| Molecular Formula | C37H40N4O8 |
| Molecular Weight | 668.75 g/mol |
| Exact Mass | 668.28 |
| IUPAC Name | (2R,8R)-2-(1,3-benzodioxol-5-yl)-6-[1-[[3,4-bis(2-methoxyethoxy)phenyl]methyl]azetidin-3-yl]-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione |
| SMILES | COCCOc1ccc(CN2CC(N3CC(=O)N4[C@H](c5ccc6c(c5)OCO6)c5[nH]c6ccccc6c5C[C@@H]4C3=O)C2)cc1OCCOC |
| InChI | InChI=1S/C37H40N4O8/c1-44-11-13-46-30-9-7-23(15-32(30)47-14-12-45-2)18-39-19-25(20-39)40-21-34(42)41-29(37(40)43)17-27-26-5-3-4-6-28(26)38-35(27)36(41)24-8-10-31-33(16-24)49-22-48-31/h3-10,15-16,25,29,36,38H,11-14,17-22H2,1-2H3/t29-,36-/m1/s1 |
| InChIKey | ZTGKPADJBHOMPY-JQMWFGOGSA-N |
| XLogP | 3.52 |
| TPSA | 115.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.75 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|