C31H29N7O6 — CID 122457022
2-[4-[(8S)-2-(1,3-benzodioxol-5-yl)-4,7-dioxo-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraen-6-yl]piperidin-1-yl]-N-hydroxypyrimidine-5-carboxamide (PubChem CID 122457022) has the molecular formula C31H29N7O6 and a molecular weight of 595.62 g/mol. Its IUPAC name is 2-[4-[(8S)-2-(1,3-benzodioxol-5-yl)-4,7-dioxo-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraen-6-yl]piperidin-1-yl]-N-hydroxypyrimidine-5-carboxamide.
| Compound Name | 2-[4-[(8S)-2-(1,3-benzodioxol-5-yl)-4,7-dioxo-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraen-6-yl]piperidin-1-yl]-N-hydroxypyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 122457022 |
| Molecular Formula | C31H29N7O6 |
| Molecular Weight | 595.62 g/mol |
| Exact Mass | 595.22 |
| IUPAC Name | 2-[4-[(8S)-2-(1,3-benzodioxol-5-yl)-4,7-dioxo-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraen-6-yl]piperidin-1-yl]-N-hydroxypyrimidine-5-carboxamide |
| SMILES | O=C(NO)c1cnc(N2CCC(N3CC(=O)N4C(c5ccc6c(c5)OCO6)c5[nH]c6ccccc6c5C[C@H]4C3=O)CC2)nc1 |
| InChI | InChI=1S/C31H29N7O6/c39-26-15-37(19-7-9-36(10-8-19)31-32-13-18(14-33-31)29(40)35-42)30(41)23-12-21-20-3-1-2-4-22(20)34-27(21)28(38(23)26)17-5-6-24-25(11-17)44-16-43-24/h1-6,11,13-14,19,23,28,34,42H,7-10,12,15-16H2,(H,35,40)/t23-,28?/m0/s1 |
| InChIKey | OLAMQCFUIKCJKY-UHFKCPIBSA-N |
| XLogP | 2.16 |
| TPSA | 153.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.62 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|