C30H24N4O6 — CID 171347069
(E)-3-[4-[2-(1,3-benzodioxol-5-yl)-4,7-dioxo-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraen-6-yl]phenyl]-N-hydroxyprop-2-enamide (PubChem CID 171347069) has the molecular formula C30H24N4O6 and a molecular weight of 536.54 g/mol. Its IUPAC name is (E)-3-[4-[2-(1,3-benzodioxol-5-yl)-4,7-dioxo-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraen-6-yl]phenyl]-N-hydroxyprop-2-enamide.
| Compound Name | (E)-3-[4-[2-(1,3-benzodioxol-5-yl)-4,7-dioxo-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraen-6-yl]phenyl]-N-hydroxyprop-2-enamide |
|---|---|
| PubChem CID | 171347069 |
| Molecular Formula | C30H24N4O6 |
| Molecular Weight | 536.54 g/mol |
| Exact Mass | 536.17 |
| IUPAC Name | (E)-3-[4-[2-(1,3-benzodioxol-5-yl)-4,7-dioxo-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraen-6-yl]phenyl]-N-hydroxyprop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(N2CC(=O)N3C(Cc4c([nH]c5ccccc45)C3c3ccc4c(c3)OCO4)C2=O)cc1)NO |
| InChI | InChI=1S/C30H24N4O6/c35-26(32-38)12-7-17-5-9-19(10-6-17)33-15-27(36)34-23(30(33)37)14-21-20-3-1-2-4-22(20)31-28(21)29(34)18-8-11-24-25(13-18)40-16-39-24/h1-13,23,29,31,38H,14-16H2,(H,32,35)/b12-7+ |
| InChIKey | DOKZSZOGYUKABQ-KPKJPENVSA-N |
| XLogP | 3.30 |
| TPSA | 124.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.54 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|