C36H37N5O6 — CID 53239486
tert-butyl 4-[4-[(2R,8R)-2-(1,3-benzodioxol-5-yl)-4,7-dioxo-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraen-6-yl]phenyl]piperazine-1-carboxylate (PubChem CID 53239486) has the molecular formula C36H37N5O6 and a molecular weight of 635.72 g/mol. Its IUPAC name is tert-butyl 4-[4-[(2R,8R)-2-(1,3-benzodioxol-5-yl)-4,7-dioxo-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraen-6-yl]phenyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-[(2R,8R)-2-(1,3-benzodioxol-5-yl)-4,7-dioxo-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraen-6-yl]phenyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 53239486 |
| Molecular Formula | C36H37N5O6 |
| Molecular Weight | 635.72 g/mol |
| Exact Mass | 635.27 |
| IUPAC Name | tert-butyl 4-[4-[(2R,8R)-2-(1,3-benzodioxol-5-yl)-4,7-dioxo-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraen-6-yl]phenyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2ccc(N3CC(=O)N4[C@H](c5ccc6c(c5)OCO6)c5[nH]c6ccccc6c5C[C@@H]4C3=O)cc2)CC1 |
| InChI | InChI=1S/C36H37N5O6/c1-36(2,3)47-35(44)39-16-14-38(15-17-39)23-9-11-24(12-10-23)40-20-31(42)41-28(34(40)43)19-26-25-6-4-5-7-27(25)37-32(26)33(41)22-8-13-29-30(18-22)46-21-45-29/h4-13,18,28,33,37H,14-17,19-21H2,1-3H3/t28-,33-/m1/s1 |
| InChIKey | RCTXMFIXCZDBNE-LHXZUMEBSA-N |
| XLogP | 4.84 |
| TPSA | 107.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.72 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|