C25H22N2O4 — CID 7096513
(2R,12S)-6,7-dimethoxy-12-(5-methylfuran-2-yl)-10,20-diazapentacyclo[11.7.0.02,10.03,8.014,19]icosa-1(13),3(8),4,6,14,16,18-heptaen-9-one (PubChem CID 7096513) has the molecular formula C25H22N2O4 and a molecular weight of 414.46 g/mol. Its IUPAC name is (2R,12S)-6,7-dimethoxy-12-(5-methylfuran-2-yl)-10,20-diazapentacyclo[11.7.0.02,10.03,8.014,19]icosa-1(13),3(8),4,6,14,16,18-heptaen-9-one.
| Compound Name | (2R,12S)-6,7-dimethoxy-12-(5-methylfuran-2-yl)-10,20-diazapentacyclo[11.7.0.02,10.03,8.014,19]icosa-1(13),3(8),4,6,14,16,18-heptaen-9-one |
|---|---|
| PubChem CID | 7096513 |
| Molecular Formula | C25H22N2O4 |
| Molecular Weight | 414.46 g/mol |
| Exact Mass | 414.16 |
| IUPAC Name | (2R,12S)-6,7-dimethoxy-12-(5-methylfuran-2-yl)-10,20-diazapentacyclo[11.7.0.02,10.03,8.014,19]icosa-1(13),3(8),4,6,14,16,18-heptaen-9-one |
| SMILES | COc1ccc2c(c1OC)C(=O)N1C[C@@H](c3ccc(C)o3)c3c([nH]c4ccccc34)[C@@H]21 |
| InChI | InChI=1S/C25H22N2O4/c1-13-8-10-18(31-13)16-12-27-23(22-20(16)14-6-4-5-7-17(14)26-22)15-9-11-19(29-2)24(30-3)21(15)25(27)28/h4-11,16,23,26H,12H2,1-3H3/t16-,23+/m0/s1 |
| InChIKey | ASWRFPZKDMGSKF-QMHKHESXSA-N |
| XLogP | 4.78 |
| TPSA | 67.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.46 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|