C30H28N2O5 — CID 46933445
(3aR,5R,10bR)-2-benzyl-5-(3,4,5-trimethoxyphenyl)-4,5,10,10b-tetrahydro-3aH-pyrrolo[3,4-a]carbazole-1,3-dione (PubChem CID 46933445) has the molecular formula C30H28N2O5 and a molecular weight of 496.56 g/mol. Its IUPAC name is (3aR,5R,10bR)-2-benzyl-5-(3,4,5-trimethoxyphenyl)-4,5,10,10b-tetrahydro-3aH-pyrrolo[3,4-a]carbazole-1,3-dione.
| Compound Name | (3aR,5R,10bR)-2-benzyl-5-(3,4,5-trimethoxyphenyl)-4,5,10,10b-tetrahydro-3aH-pyrrolo[3,4-a]carbazole-1,3-dione |
|---|---|
| PubChem CID | 46933445 |
| Molecular Formula | C30H28N2O5 |
| Molecular Weight | 496.56 g/mol |
| Exact Mass | 496.20 |
| IUPAC Name | (3aR,5R,10bR)-2-benzyl-5-(3,4,5-trimethoxyphenyl)-4,5,10,10b-tetrahydro-3aH-pyrrolo[3,4-a]carbazole-1,3-dione |
| SMILES | COc1cc([C@H]2C[C@H]3C(=O)N(Cc4ccccc4)C(=O)[C@H]3c3[nH]c4ccccc4c32)cc(OC)c1OC |
| InChI | InChI=1S/C30H28N2O5/c1-35-23-13-18(14-24(36-2)28(23)37-3)20-15-21-26(27-25(20)19-11-7-8-12-22(19)31-27)30(34)32(29(21)33)16-17-9-5-4-6-10-17/h4-14,20-21,26,31H,15-16H2,1-3H3/t20-,21-,26-/m1/s1 |
| InChIKey | VUDYRKQGAKYGMD-IPVFLDMMSA-N |
| XLogP | 5.00 |
| TPSA | 80.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.56 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|