C22H27N3O3 — CID 110533658
5-benzyl-3-(3,4,5-trimethoxyphenyl)-2,3,3a,4,6,7-hexahydropyrazolo[4,3-c]pyridine (PubChem CID 110533658) has the molecular formula C22H27N3O3 and a molecular weight of 381.48 g/mol. Its IUPAC name is 5-benzyl-3-(3,4,5-trimethoxyphenyl)-2,3,3a,4,6,7-hexahydropyrazolo[4,3-c]pyridine.
| Compound Name | 5-benzyl-3-(3,4,5-trimethoxyphenyl)-2,3,3a,4,6,7-hexahydropyrazolo[4,3-c]pyridine |
|---|---|
| PubChem CID | 110533658 |
| Molecular Formula | C22H27N3O3 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.21 |
| IUPAC Name | 5-benzyl-3-(3,4,5-trimethoxyphenyl)-2,3,3a,4,6,7-hexahydropyrazolo[4,3-c]pyridine |
| SMILES | COc1cc(C2NN=C3CCN(Cc4ccccc4)CC32)cc(OC)c1OC |
| InChI | InChI=1S/C22H27N3O3/c1-26-19-11-16(12-20(27-2)22(19)28-3)21-17-14-25(10-9-18(17)23-24-21)13-15-7-5-4-6-8-15/h4-8,11-12,17,21,24H,9-10,13-14H2,1-3H3 |
| InChIKey | ITPXVRXMKYNUSU-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 55.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |