C23H28N4O4 — CID 110531083
5-benzyl-3-(3-methoxy-5-nitro-4-propan-2-yloxyphenyl)-2,3,3a,4,6,7-hexahydropyrazolo[4,3-c]pyridine (PubChem CID 110531083) has the molecular formula C23H28N4O4 and a molecular weight of 424.50 g/mol. Its IUPAC name is 5-benzyl-3-(3-methoxy-5-nitro-4-propan-2-yloxyphenyl)-2,3,3a,4,6,7-hexahydropyrazolo[4,3-c]pyridine.
| Compound Name | 5-benzyl-3-(3-methoxy-5-nitro-4-propan-2-yloxyphenyl)-2,3,3a,4,6,7-hexahydropyrazolo[4,3-c]pyridine |
|---|---|
| PubChem CID | 110531083 |
| Molecular Formula | C23H28N4O4 |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.21 |
| IUPAC Name | 5-benzyl-3-(3-methoxy-5-nitro-4-propan-2-yloxyphenyl)-2,3,3a,4,6,7-hexahydropyrazolo[4,3-c]pyridine |
| SMILES | COc1cc(C2NN=C3CCN(Cc4ccccc4)CC32)cc([N+](=O)[O-])c1OC(C)C |
| InChI | InChI=1S/C23H28N4O4/c1-15(2)31-23-20(27(28)29)11-17(12-21(23)30-3)22-18-14-26(10-9-19(18)24-25-22)13-16-7-5-4-6-8-16/h4-8,11-12,15,18,22,25H,9-10,13-14H2,1-3H3 |
| InChIKey | SQFUVOHYRVHJSE-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 89.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|