C19H20N4O3 — CID 110535684
4-(5-benzyl-2,3,3a,4,6,7-hexahydropyrazolo[4,3-c]pyridin-3-yl)-2-nitrophenol (PubChem CID 110535684) has the molecular formula C19H20N4O3 and a molecular weight of 352.39 g/mol. Its IUPAC name is 4-(5-benzyl-2,3,3a,4,6,7-hexahydropyrazolo[4,3-c]pyridin-3-yl)-2-nitrophenol.
| Compound Name | 4-(5-benzyl-2,3,3a,4,6,7-hexahydropyrazolo[4,3-c]pyridin-3-yl)-2-nitrophenol |
|---|---|
| PubChem CID | 110535684 |
| Molecular Formula | C19H20N4O3 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | 4-(5-benzyl-2,3,3a,4,6,7-hexahydropyrazolo[4,3-c]pyridin-3-yl)-2-nitrophenol |
| SMILES | O=[N+]([O-])c1cc(C2NN=C3CCN(Cc4ccccc4)CC32)ccc1O |
| InChI | InChI=1S/C19H20N4O3/c24-18-7-6-14(10-17(18)23(25)26)19-15-12-22(9-8-16(15)20-21-19)11-13-4-2-1-3-5-13/h1-7,10,15,19,21,24H,8-9,11-12H2 |
| InChIKey | YSUVOUMHRYTEHS-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 91.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|