C15H20N4O3 — CID 110538374
2-nitro-4-(5-propyl-2,3,3a,4,6,7-hexahydropyrazolo[4,3-c]pyridin-3-yl)phenol (PubChem CID 110538374) has the molecular formula C15H20N4O3 and a molecular weight of 304.35 g/mol. Its IUPAC name is 2-nitro-4-(5-propyl-2,3,3a,4,6,7-hexahydropyrazolo[4,3-c]pyridin-3-yl)phenol.
| Compound Name | 2-nitro-4-(5-propyl-2,3,3a,4,6,7-hexahydropyrazolo[4,3-c]pyridin-3-yl)phenol |
|---|---|
| PubChem CID | 110538374 |
| Molecular Formula | C15H20N4O3 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.15 |
| IUPAC Name | 2-nitro-4-(5-propyl-2,3,3a,4,6,7-hexahydropyrazolo[4,3-c]pyridin-3-yl)phenol |
| SMILES | CCCN1CCC2=NNC(c3ccc(O)c([N+](=O)[O-])c3)C2C1 |
| InChI | InChI=1S/C15H20N4O3/c1-2-6-18-7-5-12-11(9-18)15(17-16-12)10-3-4-14(20)13(8-10)19(21)22/h3-4,8,11,15,17,20H,2,5-7,9H2,1H3 |
| InChIKey | QEJGWPKMJRMLDR-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 91.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|