C30H24N2O5 — CID 46933903
2-benzyl-5-(3,4,5-trimethoxyphenyl)-10H-pyrrolo[3,4-a]carbazole-1,3-dione (PubChem CID 46933903) has the molecular formula C30H24N2O5 and a molecular weight of 492.53 g/mol. Its IUPAC name is 2-benzyl-5-(3,4,5-trimethoxyphenyl)-10H-pyrrolo[3,4-a]carbazole-1,3-dione.
| Compound Name | 2-benzyl-5-(3,4,5-trimethoxyphenyl)-10H-pyrrolo[3,4-a]carbazole-1,3-dione |
|---|---|
| PubChem CID | 46933903 |
| Molecular Formula | C30H24N2O5 |
| Molecular Weight | 492.53 g/mol |
| Exact Mass | 492.17 |
| IUPAC Name | 2-benzyl-5-(3,4,5-trimethoxyphenyl)-10H-pyrrolo[3,4-a]carbazole-1,3-dione |
| SMILES | COc1cc(-c2cc3c(c4[nH]c5ccccc5c24)C(=O)N(Cc2ccccc2)C3=O)cc(OC)c1OC |
| InChI | InChI=1S/C30H24N2O5/c1-35-23-13-18(14-24(36-2)28(23)37-3)20-15-21-26(27-25(20)19-11-7-8-12-22(19)31-27)30(34)32(29(21)33)16-17-9-5-4-6-10-17/h4-15,31H,16H2,1-3H3 |
| InChIKey | SJGOTPFYMWXPML-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 80.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.53 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|