C32H27NO5 — CID 10505727
14,15-dimethoxy-10-[(4-methoxyphenyl)methyl]-6-phenylmethoxy-10-azatetracyclo[7.6.1.02,7.012,16]hexadeca-1,3,5,7,9(16),12,14-heptaen-11-one (PubChem CID 10505727) has the molecular formula C32H27NO5 and a molecular weight of 505.57 g/mol. Its IUPAC name is 14,15-dimethoxy-10-[(4-methoxyphenyl)methyl]-6-phenylmethoxy-10-azatetracyclo[7.6.1.02,7.012,16]hexadeca-1,3,5,7,9(16),12,14-heptaen-11-one.
| Compound Name | 14,15-dimethoxy-10-[(4-methoxyphenyl)methyl]-6-phenylmethoxy-10-azatetracyclo[7.6.1.02,7.012,16]hexadeca-1,3,5,7,9(16),12,14-heptaen-11-one |
|---|---|
| PubChem CID | 10505727 |
| Molecular Formula | C32H27NO5 |
| Molecular Weight | 505.57 g/mol |
| Exact Mass | 505.19 |
| IUPAC Name | 14,15-dimethoxy-10-[(4-methoxyphenyl)methyl]-6-phenylmethoxy-10-azatetracyclo[7.6.1.02,7.012,16]hexadeca-1,3,5,7,9(16),12,14-heptaen-11-one |
| SMILES | COc1ccc(CN2C(=O)c3cc(OC)c(OC)c4c3c2cc2c(OCc3ccccc3)cccc24)cc1 |
| InChI | InChI=1S/C32H27NO5/c1-35-22-14-12-20(13-15-22)18-33-26-16-24-23(10-7-11-27(24)38-19-21-8-5-4-6-9-21)30-29(26)25(32(33)34)17-28(36-2)31(30)37-3/h4-17H,18-19H2,1-3H3 |
| InChIKey | QLMOYJNOXBWOLH-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.57 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|