C20H17NO3 — CID 155194845
6-(hydroxymethyl)-1-[(4-methoxyphenyl)methyl]benzo[cd]indol-2-one (PubChem CID 155194845) has the molecular formula C20H17NO3 and a molecular weight of 319.36 g/mol. Its IUPAC name is 6-(hydroxymethyl)-1-[(4-methoxyphenyl)methyl]benzo[cd]indol-2-one.
| Compound Name | 6-(hydroxymethyl)-1-[(4-methoxyphenyl)methyl]benzo[cd]indol-2-one |
|---|---|
| PubChem CID | 155194845 |
| Molecular Formula | C20H17NO3 |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | 6-(hydroxymethyl)-1-[(4-methoxyphenyl)methyl]benzo[cd]indol-2-one |
| SMILES | COc1ccc(CN2C(=O)c3cccc4c(CO)ccc2c34)cc1 |
| InChI | InChI=1S/C20H17NO3/c1-24-15-8-5-13(6-9-15)11-21-18-10-7-14(12-22)16-3-2-4-17(19(16)18)20(21)23/h2-10,22H,11-12H2,1H3 |
| InChIKey | AHWRCLQBPGBWNO-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |