C17H12ClN3O2 — CID 163259541
9-chloro-2-[(4-methoxyphenyl)methyl]-2,10,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-3-one (PubChem CID 163259541) has the molecular formula C17H12ClN3O2 and a molecular weight of 325.76 g/mol. Its IUPAC name is 9-chloro-2-[(4-methoxyphenyl)methyl]-2,10,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-3-one.
| Compound Name | 9-chloro-2-[(4-methoxyphenyl)methyl]-2,10,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-3-one |
|---|---|
| PubChem CID | 163259541 |
| Molecular Formula | C17H12ClN3O2 |
| Molecular Weight | 325.76 g/mol |
| Exact Mass | 325.06 |
| IUPAC Name | 9-chloro-2-[(4-methoxyphenyl)methyl]-2,10,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-3-one |
| SMILES | COc1ccc(CN2C(=O)c3cccc4c(Cl)nnc2c34)cc1 |
| InChI | InChI=1S/C17H12ClN3O2/c1-23-11-7-5-10(6-8-11)9-21-16-14-12(15(18)19-20-16)3-2-4-13(14)17(21)22/h2-8H,9H2,1H3 |
| InChIKey | JHCQZMCESBSUPD-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.76 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |