C27H27N5O2 — CID 155207740
2-[(4-methoxyphenyl)methyl]-9-[(1-piperidin-4-ylpyrazol-4-yl)methyl]-2,11-diazatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-3-one (PubChem CID 155207740) has the molecular formula C27H27N5O2 and a molecular weight of 453.55 g/mol. Its IUPAC name is 2-[(4-methoxyphenyl)methyl]-9-[(1-piperidin-4-ylpyrazol-4-yl)methyl]-2,11-diazatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-3-one.
| Compound Name | 2-[(4-methoxyphenyl)methyl]-9-[(1-piperidin-4-ylpyrazol-4-yl)methyl]-2,11-diazatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-3-one |
|---|---|
| PubChem CID | 155207740 |
| Molecular Formula | C27H27N5O2 |
| Molecular Weight | 453.55 g/mol |
| Exact Mass | 453.22 |
| IUPAC Name | 2-[(4-methoxyphenyl)methyl]-9-[(1-piperidin-4-ylpyrazol-4-yl)methyl]-2,11-diazatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-3-one |
| SMILES | COc1ccc(CN2C(=O)c3cccc4c(Cc5cnn(C6CCNCC6)c5)cnc2c34)cc1 |
| InChI | InChI=1S/C27H27N5O2/c1-34-22-7-5-18(6-8-22)16-31-26-25-23(3-2-4-24(25)27(31)33)20(15-29-26)13-19-14-30-32(17-19)21-9-11-28-12-10-21/h2-8,14-15,17,21,28H,9-13,16H2,1H3 |
| InChIKey | KWBLSDHPSSTPDZ-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.55 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |