C28H30N4O2 — CID 10456648
4-[4-[1-[(4-methoxyphenyl)methyl]-2-oxobenzo[cd]indol-6-yl]-1,4-diazepan-1-yl]butanenitrile (PubChem CID 10456648) has the molecular formula C28H30N4O2 and a molecular weight of 454.57 g/mol. Its IUPAC name is 4-[4-[1-[(4-methoxyphenyl)methyl]-2-oxobenzo[cd]indol-6-yl]-1,4-diazepan-1-yl]butanenitrile.
| Compound Name | 4-[4-[1-[(4-methoxyphenyl)methyl]-2-oxobenzo[cd]indol-6-yl]-1,4-diazepan-1-yl]butanenitrile |
|---|---|
| PubChem CID | 10456648 |
| Molecular Formula | C28H30N4O2 |
| Molecular Weight | 454.57 g/mol |
| Exact Mass | 454.24 |
| IUPAC Name | 4-[4-[1-[(4-methoxyphenyl)methyl]-2-oxobenzo[cd]indol-6-yl]-1,4-diazepan-1-yl]butanenitrile |
| SMILES | COc1ccc(CN2C(=O)c3cccc4c(N5CCCN(CCCC#N)CC5)ccc2c34)cc1 |
| InChI | InChI=1S/C28H30N4O2/c1-34-22-10-8-21(9-11-22)20-32-26-13-12-25(23-6-4-7-24(27(23)26)28(32)33)31-17-5-16-30(18-19-31)15-3-2-14-29/h4,6-13H,2-3,5,15-20H2,1H3 |
| InChIKey | PBCZCBOTOOLKKZ-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 59.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.57 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|