About 6-[4-(2-ethoxyethyl)-1,4-diazepan-1-yl]-1-prop-2-enylbenzo[cd]indol-2-one
6-[4-(2-ethoxyethyl)-1,4-diazepan-1-yl]-1-prop-2-enylbenzo[cd]indol-2-one (PubChem CID 18757984) has the molecular formula C23H29N3O2
and a molecular weight of 379.50 g/mol. Its IUPAC name is 6-[4-(2-ethoxyethyl)-1,4-diazepan-1-yl]-1-prop-2-enylbenzo[cd]indol-2-one.
Molecular Properties
| Compound Name | 6-[4-(2-ethoxyethyl)-1,4-diazepan-1-yl]-1-prop-2-enylbenzo[cd]indol-2-one |
| PubChem CID | 18757984 |
| Molecular Formula | C23H29N3O2 |
| Molecular Weight | 379.50 g/mol |
| Exact Mass | 379.23 |
| IUPAC Name | 6-[4-(2-ethoxyethyl)-1,4-diazepan-1-yl]-1-prop-2-enylbenzo[cd]indol-2-one |
| SMILES | C=CCN1C(=O)c2cccc3c(N4CCCN(CCOCC)CC4)ccc1c23 |
| InChI | InChI=1S/C23H29N3O2/c1-3-11-26-21-10-9-20(18-7-5-8-19(22(18)21)23(26)27)25-13-6-12-24(14-15-25)16-17-28-4-2/h3,5,7-10H,1,4,6,11-17H2,2H3 |
| InChIKey | YYTVLLHMYBNIAL-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 36.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 379.50 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 6-[4-(2-ethoxyethyl)-1,4-diazepan-1-yl]-1-prop-2-enylbenzo[cd]indol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[4-(2-ethoxyethyl)-1,4-diazepan-1-yl]-1-prop-2-enylbenzo[cd]indol-2-one?
The IUPAC name of 6-[4-(2-ethoxyethyl)-1,4-diazepan-1-yl]-1-prop-2-enylbenzo[cd]indol-2-one (CID 18757984) is 6-[4-(2-ethoxyethyl)-1,4-diazepan-1-yl]-1-prop-2-enylbenzo[cd]indol-2-one.
What is the SMILES notation for 6-[4-(2-ethoxyethyl)-1,4-diazepan-1-yl]-1-prop-2-enylbenzo[cd]indol-2-one?
The canonical SMILES for 6-[4-(2-ethoxyethyl)-1,4-diazepan-1-yl]-1-prop-2-enylbenzo[cd]indol-2-one is C=CCN1C(=O)c2cccc3c(N4CCCN(CCOCC)CC4)ccc1c23.
What is the InChIKey of 6-[4-(2-ethoxyethyl)-1,4-diazepan-1-yl]-1-prop-2-enylbenzo[cd]indol-2-one?
The InChIKey is YYTVLLHMYBNIAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H29N3O2/c1-3-11-26-21-10-9-20(18-7-5-8-19(22(18)21)23(26)27)25-13-6-12-24(14-15-25)16-17-28-4-2/h3,5,7-10H,1,4,6,11-17H2,2H3.
What are the key properties of 6-[4-(2-ethoxyethyl)-1,4-diazepan-1-yl]-1-prop-2-enylbenzo[cd]indol-2-one?
6-[4-(2-ethoxyethyl)-1,4-diazepan-1-yl]-1-prop-2-enylbenzo[cd]indol-2-one has a molecular weight of 379.50 g/mol, XLogP of 3.53, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[4-(2-ethoxyethyl)-1,4-diazepan-1-yl]-1-prop-2-enylbenzo[cd]indol-2-one is sourced from PubChem (CID 18757984), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).