C23H29N3O2 — CID 18757984
6-[4-(2-ethoxyethyl)-1,4-diazepan-1-yl]-1-prop-2-enylbenzo[cd]indol-2-one (PubChem CID 18757984) has the molecular formula C23H29N3O2 and a molecular weight of 379.50 g/mol. Its IUPAC name is 6-[4-(2-ethoxyethyl)-1,4-diazepan-1-yl]-1-prop-2-enylbenzo[cd]indol-2-one.
| Compound Name | 6-[4-(2-ethoxyethyl)-1,4-diazepan-1-yl]-1-prop-2-enylbenzo[cd]indol-2-one |
|---|---|
| PubChem CID | 18757984 |
| Molecular Formula | C23H29N3O2 |
| Molecular Weight | 379.50 g/mol |
| Exact Mass | 379.23 |
| IUPAC Name | 6-[4-(2-ethoxyethyl)-1,4-diazepan-1-yl]-1-prop-2-enylbenzo[cd]indol-2-one |
| SMILES | C=CCN1C(=O)c2cccc3c(N4CCCN(CCOCC)CC4)ccc1c23 |
| InChI | InChI=1S/C23H29N3O2/c1-3-11-26-21-10-9-20(18-7-5-8-19(22(18)21)23(26)27)25-13-6-12-24(14-15-25)16-17-28-4-2/h3,5,7-10H,1,4,6,11-17H2,2H3 |
| InChIKey | YYTVLLHMYBNIAL-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 36.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.50 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|