C25H35ClN4O2 — CID 172857623
2-[4-(2-heptyl-1,3-dioxobenzo[de]isoquinolin-6-yl)piperazin-1-yl]ethylazanium chloride (PubChem CID 172857623) has the molecular formula C25H35ClN4O2 and a molecular weight of 459.03 g/mol. Its IUPAC name is 2-[4-(2-heptyl-1,3-dioxobenzo[de]isoquinolin-6-yl)piperazin-1-yl]ethylazanium chloride.
| Compound Name | 2-[4-(2-heptyl-1,3-dioxobenzo[de]isoquinolin-6-yl)piperazin-1-yl]ethylazanium chloride |
|---|---|
| PubChem CID | 172857623 |
| Molecular Formula | C25H35ClN4O2 |
| Molecular Weight | 459.03 g/mol |
| Exact Mass | 458.24 |
| IUPAC Name | 2-[4-(2-heptyl-1,3-dioxobenzo[de]isoquinolin-6-yl)piperazin-1-yl]ethylazanium chloride |
| SMILES | CCCCCCCN1C(=O)c2cccc3c(N4CCN(CC[NH3+])CC4)ccc(c23)C1=O.[Cl-] |
| InChI | InChI=1S/C25H34N4O2.ClH/c1-2-3-4-5-6-13-29-24(30)20-9-7-8-19-22(11-10-21(23(19)20)25(29)31)28-17-15-27(14-12-26)16-18-28;/h7-11H,2-6,12-18,26H2,1H3;1H |
| InChIKey | YXTIZSQCXWNOEG-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 71.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.03 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|