About benzyl 2-[4-[2-oxo-1-(2-phenylethyl)benzo[cd]indol-6-yl]-1,4-diazepan-1-yl]acetate
benzyl 2-[4-[2-oxo-1-(2-phenylethyl)benzo[cd]indol-6-yl]-1,4-diazepan-1-yl]acetate (PubChem CID 10324363) has the molecular formula C33H33N3O3
and a molecular weight of 519.65 g/mol. Its IUPAC name is benzyl 2-[4-[2-oxo-1-(2-phenylethyl)benzo[cd]indol-6-yl]-1,4-diazepan-1-yl]acetate.
Molecular Properties
| Compound Name | benzyl 2-[4-[2-oxo-1-(2-phenylethyl)benzo[cd]indol-6-yl]-1,4-diazepan-1-yl]acetate |
| PubChem CID | 10324363 |
| Molecular Formula | C33H33N3O3 |
| Molecular Weight | 519.65 g/mol |
| Exact Mass | 519.25 |
| IUPAC Name | benzyl 2-[4-[2-oxo-1-(2-phenylethyl)benzo[cd]indol-6-yl]-1,4-diazepan-1-yl]acetate |
| SMILES | O=C(CN1CCCN(c2ccc3c4c(cccc24)C(=O)N3CCc2ccccc2)CC1)OCc1ccccc1 |
| InChI | InChI=1S/C33H33N3O3/c37-31(39-24-26-11-5-2-6-12-26)23-34-18-8-19-35(22-21-34)29-15-16-30-32-27(29)13-7-14-28(32)33(38)36(30)20-17-25-9-3-1-4-10-25/h1-7,9-16H,8,17-24H2 |
| InChIKey | IOIGHDGNCNLVLE-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 519.65 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze benzyl 2-[4-[2-oxo-1-(2-phenylethyl)benzo[cd]indol-6-yl]-1,4-diazepan-1-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl 2-[4-[2-oxo-1-(2-phenylethyl)benzo[cd]indol-6-yl]-1,4-diazepan-1-yl]acetate?
The IUPAC name of benzyl 2-[4-[2-oxo-1-(2-phenylethyl)benzo[cd]indol-6-yl]-1,4-diazepan-1-yl]acetate (CID 10324363) is benzyl 2-[4-[2-oxo-1-(2-phenylethyl)benzo[cd]indol-6-yl]-1,4-diazepan-1-yl]acetate.
What is the SMILES notation for benzyl 2-[4-[2-oxo-1-(2-phenylethyl)benzo[cd]indol-6-yl]-1,4-diazepan-1-yl]acetate?
The canonical SMILES for benzyl 2-[4-[2-oxo-1-(2-phenylethyl)benzo[cd]indol-6-yl]-1,4-diazepan-1-yl]acetate is O=C(CN1CCCN(c2ccc3c4c(cccc24)C(=O)N3CCc2ccccc2)CC1)OCc1ccccc1.
What is the InChIKey of benzyl 2-[4-[2-oxo-1-(2-phenylethyl)benzo[cd]indol-6-yl]-1,4-diazepan-1-yl]acetate?
The InChIKey is IOIGHDGNCNLVLE-UHFFFAOYSA-N. The full InChI is InChI=1S/C33H33N3O3/c37-31(39-24-26-11-5-2-6-12-26)23-34-18-8-19-35(22-21-34)29-15-16-30-32-27(29)13-7-14-28(32)33(38)36(30)20-17-25-9-3-1-4-10-25/h1-7,9-16H,8,17-24H2.
What are the key properties of benzyl 2-[4-[2-oxo-1-(2-phenylethyl)benzo[cd]indol-6-yl]-1,4-diazepan-1-yl]acetate?
benzyl 2-[4-[2-oxo-1-(2-phenylethyl)benzo[cd]indol-6-yl]-1,4-diazepan-1-yl]acetate has a molecular weight of 519.65 g/mol, XLogP of 5.30, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 2-[4-[2-oxo-1-(2-phenylethyl)benzo[cd]indol-6-yl]-1,4-diazepan-1-yl]acetate is sourced from PubChem (CID 10324363), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).