About 2-benzyl-3,4-diphenyl-9H-pyrido[3,4-b]indol-1-one
2-benzyl-3,4-diphenyl-9H-pyrido[3,4-b]indol-1-one (PubChem CID 15424155) has the molecular formula C30H22N2O
and a molecular weight of 426.52 g/mol. Its IUPAC name is 2-benzyl-3,4-diphenyl-9H-pyrido[3,4-b]indol-1-one.
Molecular Properties
| Compound Name | 2-benzyl-3,4-diphenyl-9H-pyrido[3,4-b]indol-1-one |
| PubChem CID | 15424155 |
| Molecular Formula | C30H22N2O |
| Molecular Weight | 426.52 g/mol |
| Exact Mass | 426.17 |
| IUPAC Name | 2-benzyl-3,4-diphenyl-9H-pyrido[3,4-b]indol-1-one |
| SMILES | O=c1c2[nH]c3ccccc3c2c(-c2ccccc2)c(-c2ccccc2)n1Cc1ccccc1 |
| InChI | InChI=1S/C30H22N2O/c33-30-28-27(24-18-10-11-19-25(24)31-28)26(22-14-6-2-7-15-22)29(23-16-8-3-9-17-23)32(30)20-21-12-4-1-5-13-21/h1-19,31H,20H2 |
| InChIKey | JHFYDPJWPUPRKT-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 37.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 426.52 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-benzyl-3,4-diphenyl-9H-pyrido[3,4-b]indol-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzyl-3,4-diphenyl-9H-pyrido[3,4-b]indol-1-one?
The IUPAC name of 2-benzyl-3,4-diphenyl-9H-pyrido[3,4-b]indol-1-one (CID 15424155) is 2-benzyl-3,4-diphenyl-9H-pyrido[3,4-b]indol-1-one.
What is the SMILES notation for 2-benzyl-3,4-diphenyl-9H-pyrido[3,4-b]indol-1-one?
The canonical SMILES for 2-benzyl-3,4-diphenyl-9H-pyrido[3,4-b]indol-1-one is O=c1c2[nH]c3ccccc3c2c(-c2ccccc2)c(-c2ccccc2)n1Cc1ccccc1.
What is the InChIKey of 2-benzyl-3,4-diphenyl-9H-pyrido[3,4-b]indol-1-one?
The InChIKey is JHFYDPJWPUPRKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H22N2O/c33-30-28-27(24-18-10-11-19-25(24)31-28)26(22-14-6-2-7-15-22)29(23-16-8-3-9-17-23)32(30)20-21-12-4-1-5-13-21/h1-19,31H,20H2.
What are the key properties of 2-benzyl-3,4-diphenyl-9H-pyrido[3,4-b]indol-1-one?
2-benzyl-3,4-diphenyl-9H-pyrido[3,4-b]indol-1-one has a molecular weight of 426.52 g/mol, XLogP of 6.87, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzyl-3,4-diphenyl-9H-pyrido[3,4-b]indol-1-one is sourced from PubChem (CID 15424155), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).